C21H18N6OS — CID 59130360
4-N-(1H-indazol-5-yl)-2-N-(2-phenoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 59130360) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is 4-N-(1H-indazol-5-yl)-2-N-(2-phenoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-5-yl)-2-N-(2-phenoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59130360 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-N-(1H-indazol-5-yl)-2-N-(2-phenoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | c1ccc(OCCNc2nc(Nc3ccc4[nH]ncc4c3)c3sccc3n2)cc1 |
| InChI | InChI=1S/C21H18N6OS/c1-2-4-16(5-3-1)28-10-9-22-21-25-18-8-11-29-19(18)20(26-21)24-15-6-7-17-14(12-15)13-23-27-17/h1-8,11-13H,9-10H2,(H,23,27)(H2,22,24,25,26) |
| InChIKey | LMBZWBONVKZWHO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|