About 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine
2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine (PubChem CID 59130480) has the molecular formula C27H21F2N3O
and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine |
| PubChem CID | 59130480 |
| Molecular Formula | C27H21F2N3O |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine |
| SMILES | CCOc1ccccc1-c1ccc(Cn2ccc3nc(-c4cccc(F)c4F)nc-3c2)cc1 |
| InChI | InChI=1S/C27H21F2N3O/c1-2-33-25-9-4-3-6-20(25)19-12-10-18(11-13-19)16-32-15-14-23-24(17-32)31-27(30-23)21-7-5-8-22(28)26(21)29/h3-15,17H,2,16H2,1H3 |
| InChIKey | JQAPTBGZAVQNPT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine?
The IUPAC name of 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine (CID 59130480) is 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine?
The canonical SMILES for 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine is CCOc1ccccc1-c1ccc(Cn2ccc3nc(-c4cccc(F)c4F)nc-3c2)cc1.
What is the InChIKey of 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine?
The InChIKey is JQAPTBGZAVQNPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21F2N3O/c1-2-33-25-9-4-3-6-20(25)19-12-10-18(11-13-19)16-32-15-14-23-24(17-32)31-27(30-23)21-7-5-8-22(28)26(21)29/h3-15,17H,2,16H2,1H3.
What are the key properties of 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine?
2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine has a molecular weight of 441.48 g/mol, XLogP of 6.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-difluorophenyl)-5-[[4-(2-ethoxyphenyl)phenyl]methyl]imidazo[4,5-c]pyridine is sourced from PubChem (CID 59130480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).