C33H25F5N4O — CID 59130484
2-(2,3-difluorophenyl)-5-[[4-[4-(3-pyrrol-1-ylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine (PubChem CID 59130484) has the molecular formula C33H25F5N4O and a molecular weight of 588.58 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-5-[[4-[4-(3-pyrrol-1-ylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-(2,3-difluorophenyl)-5-[[4-[4-(3-pyrrol-1-ylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 59130484 |
| Molecular Formula | C33H25F5N4O |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 2-(2,3-difluorophenyl)-5-[[4-[4-(3-pyrrol-1-ylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine |
| SMILES | Fc1cccc(-c2nc3ccn(Cc4ccc(-c5ccc(OCCCn6cccc6)cc5C(F)(F)F)cc4)cc-3n2)c1F |
| InChI | InChI=1S/C33H25F5N4O/c34-28-6-3-5-26(31(28)35)32-39-29-13-17-42(21-30(29)40-32)20-22-7-9-23(10-8-22)25-12-11-24(19-27(25)33(36,37)38)43-18-4-16-41-14-1-2-15-41/h1-3,5-15,17,19,21H,4,16,18,20H2 |
| InChIKey | QZUXKOMJMVHDDB-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|