C8H15NO2 — CID 59130896
methyl (2S,3S)-1-methanidyl-2-methylpyrrolidin-1-ium-3-carboxylate (PubChem CID 59130896) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is methyl (2S,3S)-1-methanidyl-2-methylpyrrolidin-1-ium-3-carboxylate.
| Compound Name | methyl (2S,3S)-1-methanidyl-2-methylpyrrolidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 59130896 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | methyl (2S,3S)-1-methanidyl-2-methylpyrrolidin-1-ium-3-carboxylate |
| SMILES | [CH2-][NH+]1CC[C@H](C(=O)OC)[C@@H]1C |
| InChI | InChI=1S/C8H15NO2/c1-6-7(8(10)11-3)4-5-9(6)2/h6-7,9H,2,4-5H2,1,3H3/t6-,7-/m0/s1 |
| InChIKey | AUHZDHVVYZUJIF-BQBZGAKWSA-N |
| XLogP | -0.76 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|