About (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol
(3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 59131053) has the molecular formula C14H18F3NO
and a molecular weight of 273.30 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol.
Molecular Properties
| Compound Name | (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol |
| PubChem CID | 59131053 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | C[C@@H]1CNC[C@H](C)C1(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO/c1-9-7-18-8-10(2)13(9,19)11-3-5-12(6-4-11)14(15,16)17/h3-6,9-10,18-19H,7-8H2,1-2H3/t9-,10+,13? |
| InChIKey | MGXITOOCQVRQIS-HWYHXSKPSA-N |
| XLogP | 2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol?
The IUPAC name of (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol (CID 59131053) is (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol.
What is the SMILES notation for (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol?
The canonical SMILES for (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol is C[C@@H]1CNC[C@H](C)C1(O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol?
The InChIKey is MGXITOOCQVRQIS-HWYHXSKPSA-N. The full InChI is InChI=1S/C14H18F3NO/c1-9-7-18-8-10(2)13(9,19)11-3-5-12(6-4-11)14(15,16)17/h3-6,9-10,18-19H,7-8H2,1-2H3/t9-,10+,13?.
What are the key properties of (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol?
(3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol has a molecular weight of 273.30 g/mol, XLogP of 2.77, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol is sourced from PubChem (CID 59131053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).