C11H12O4 — CID 59131273
1-[(1R,7S,11S)-1-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undeca-4,8-dien-8-yl]ethanone (PubChem CID 59131273) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-[(1R,7S,11S)-1-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undeca-4,8-dien-8-yl]ethanone.
| Compound Name | 1-[(1R,7S,11S)-1-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undeca-4,8-dien-8-yl]ethanone |
|---|---|
| PubChem CID | 59131273 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-[(1R,7S,11S)-1-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undeca-4,8-dien-8-yl]ethanone |
| SMILES | CC(=O)C1=CO[C@]2(O)OCC3=CC[C@H]1[C@@H]32 |
| InChI | InChI=1S/C11H12O4/c1-6(12)9-5-15-11(13)10-7(4-14-11)2-3-8(9)10/h2,5,8,10,13H,3-4H2,1H3/t8-,10-,11-/m1/s1 |
| InChIKey | DNDUNUPRPFQSQC-FBIMIBRVSA-N |
| XLogP | 0.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|