C11H16O6 — CID 59131289
methyl (1R,4R,7S,11S)-1,9-dihydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecane-8-carboxylate (PubChem CID 59131289) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl (1R,4R,7S,11S)-1,9-dihydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecane-8-carboxylate.
| Compound Name | methyl (1R,4R,7S,11S)-1,9-dihydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecane-8-carboxylate |
|---|---|
| PubChem CID | 59131289 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl (1R,4R,7S,11S)-1,9-dihydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecane-8-carboxylate |
| SMILES | COC(=O)C1C(O)O[C@]2(O)OC[C@@H]3CC[C@H]1[C@@H]32 |
| InChI | InChI=1S/C11H16O6/c1-15-9(12)7-6-3-2-5-4-16-11(14,8(5)6)17-10(7)13/h5-8,10,13-14H,2-4H2,1H3/t5-,6+,7?,8+,10?,11+/m0/s1 |
| InChIKey | SSQCWOHHZHOFPQ-OTHXREFHSA-N |
| XLogP | -0.56 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |