methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate

C12H16O3 — CID 59131293

IUPACmethyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate
SMILESCOC(=O)C1=CCC2OCC3CCC1C32
InChIInChI=1S/C12H16O3/c1-14-12(13)9-4-5-10-11-7(6-15-10)2-3-8(9)11/h4,7-8,10-11H,2-3,5-6H2,1H3
InChIKeyVKQUCKIFTDXGRG-UHFFFAOYSA-N
MW208.26 g/mol
LogP1.53
Rot. Bonds1

About methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate

methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 59131293) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.

Molecular Properties

Compound Namemethyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate
PubChem CID59131293
Molecular FormulaC12H16O3
Molecular Weight208.26 g/mol
Exact Mass208.11
IUPAC Namemethyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate
SMILESCOC(=O)C1=CCC2OCC3CCC1C32
InChIInChI=1S/C12H16O3/c1-14-12(13)9-4-5-10-11-7(6-15-10)2-3-8(9)11/h4,7-8,10-11H,2-3,5-6H2,1H3
InChIKeyVKQUCKIFTDXGRG-UHFFFAOYSA-N
XLogP1.53
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
The IUPAC name of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (CID 59131293) is methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
What is the SMILES notation for methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
The canonical SMILES for methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate is COC(=O)C1=CCC2OCC3CCC1C32.
What is the InChIKey of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
The InChIKey is VKQUCKIFTDXGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-14-12(13)9-4-5-10-11-7(6-15-10)2-3-8(9)11/h4,7-8,10-11H,2-3,5-6H2,1H3.
What are the key properties of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate is sourced from PubChem (CID 59131293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).