About methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate
methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 59131293) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
Molecular Properties
| Compound Name | methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| PubChem CID | 59131293 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CCC2OCC3CCC1C32 |
| InChI | InChI=1S/C12H16O3/c1-14-12(13)9-4-5-10-11-7(6-15-10)2-3-8(9)11/h4,7-8,10-11H,2-3,5-6H2,1H3 |
| InChIKey | VKQUCKIFTDXGRG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
The IUPAC name of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (CID 59131293) is methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
What is the SMILES notation for methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
The canonical SMILES for methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate is COC(=O)C1=CCC2OCC3CCC1C32.
What is the InChIKey of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
The InChIKey is VKQUCKIFTDXGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-14-12(13)9-4-5-10-11-7(6-15-10)2-3-8(9)11/h4,7-8,10-11H,2-3,5-6H2,1H3.
What are the key properties of methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate?
methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate is sourced from PubChem (CID 59131293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).