C11H14O4 — CID 59131294
1-[(1S,4S,7S,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]ethanone (PubChem CID 59131294) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-[(1S,4S,7S,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]ethanone.
| Compound Name | 1-[(1S,4S,7S,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]ethanone |
|---|---|
| PubChem CID | 59131294 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-[(1S,4S,7S,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]ethanone |
| SMILES | CC(=O)C1=CO[C@@H]2OC[C@]3(O)CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C11H14O4/c1-6(12)8-4-14-10-9-7(8)2-3-11(9,13)5-15-10/h4,7,9-10,13H,2-3,5H2,1H3/t7-,9-,10-,11-/m1/s1 |
| InChIKey | AKCVUPRTJWYRRQ-QCNRFFRDSA-N |
| XLogP | 0.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |