C11H12O4 — CID 59131299
(1S,7S,10S,11R,12S)-10-hydroxy-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-4-en-3-one (PubChem CID 59131299) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (1S,7S,10S,11R,12S)-10-hydroxy-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-4-en-3-one.
| Compound Name | (1S,7S,10S,11R,12S)-10-hydroxy-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-4-en-3-one |
|---|---|
| PubChem CID | 59131299 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1S,7S,10S,11R,12S)-10-hydroxy-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-4-en-3-one |
| SMILES | O=C1O[C@H]2C[C@@]3(O)CO[C@H]4CC=C1[C@@H]2[C@H]43 |
| InChI | InChI=1S/C11H12O4/c12-10-5-1-2-6-9-8(5)7(15-10)3-11(9,13)4-14-6/h1,6-9,13H,2-4H2/t6-,7-,8-,9-,11+/m0/s1 |
| InChIKey | RZXIJAOJYKKOEZ-JIYZTFHLSA-N |
| XLogP | 0.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |