C12H15ClO5 — CID 59131301
methyl (1S,4S,5R,7S,11S)-5-chloro-4-hydroxy-1-methyl-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 59131301) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is methyl (1S,4S,5R,7S,11S)-5-chloro-4-hydroxy-1-methyl-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1S,4S,5R,7S,11S)-5-chloro-4-hydroxy-1-methyl-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 59131301 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | methyl (1S,4S,5R,7S,11S)-5-chloro-4-hydroxy-1-methyl-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CO[C@]2(C)OC[C@]3(O)[C@H](Cl)C[C@H]1[C@H]23 |
| InChI | InChI=1S/C12H15ClO5/c1-11-9-6(7(4-17-11)10(14)16-2)3-8(13)12(9,15)5-18-11/h4,6,8-9,15H,3,5H2,1-2H3/t6-,8-,9-,11-,12+/m1/s1 |
| InChIKey | WQSZISQCNLRYFF-VQDYQRKTSA-N |
| XLogP | 0.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|