About 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane
2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane (PubChem CID 591316) has the molecular formula C15H28Si2
and a molecular weight of 264.56 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane |
| PubChem CID | 591316 |
| Molecular Formula | C15H28Si2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane |
| SMILES | C[Si](C)(C)CCC[Si](C)(C)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C15H28Si2/c1-16(2,3)9-6-10-17(4,5)15-12-13-7-8-14(15)11-13/h7-8,12-14H,6,9-11H2,1-5H3 |
| InChIKey | NQSBJLNTFCDEQP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane?
The IUPAC name of 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane (CID 591316) is 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane.
What is the SMILES notation for 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane?
The canonical SMILES for 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane is C[Si](C)(C)CCC[Si](C)(C)C1=CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane?
The InChIKey is NQSBJLNTFCDEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28Si2/c1-16(2,3)9-6-10-17(4,5)15-12-13-7-8-14(15)11-13/h7-8,12-14H,6,9-11H2,1-5H3.
What are the key properties of 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane?
2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane has a molecular weight of 264.56 g/mol, XLogP of 5.09, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hepta-2,5-dienyl-dimethyl-(3-trimethylsilylpropyl)silane is sourced from PubChem (CID 591316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).