C30H30FN3O3 — CID 59131611
5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile (PubChem CID 59131611) has the molecular formula C30H30FN3O3 and a molecular weight of 499.59 g/mol. Its IUPAC name is 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 59131611 |
| Molecular Formula | C30H30FN3O3 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](Cc1ccccc1)NC(=O)N(Cc1ccc(F)c(C#N)c1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C30H30FN3O3/c1-30(2)36-27-25(16-20-9-5-3-6-10-20)33-29(35)34(19-22-13-14-24(31)23(15-22)18-32)26(28(27)37-30)17-21-11-7-4-8-12-21/h3-15,25-28H,16-17,19H2,1-2H3,(H,33,35)/t25-,26-,27+,28+/m1/s1 |
| InChIKey | SLHLJJSGCIUAIU-VIJSPRBVSA-N |
| XLogP | 4.97 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |