C14H25NO — CID 59131623
1-[(3S,4aR,8aS)-5-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone (PubChem CID 59131623) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-[(3S,4aR,8aS)-5-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone.
| Compound Name | 1-[(3S,4aR,8aS)-5-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 59131623 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-[(3S,4aR,8aS)-5-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone |
| SMILES | CCCC1CCC[C@@H]2CN[C@H](C(C)=O)C[C@H]12 |
| InChI | InChI=1S/C14H25NO/c1-3-5-11-6-4-7-12-9-15-14(10(2)16)8-13(11)12/h11-15H,3-9H2,1-2H3/t11?,12-,13-,14+/m1/s1 |
| InChIKey | KESSHHUSEWQWDP-CPIKKWJDSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |