About 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine
3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine (PubChem CID 59131902) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine.
Molecular Properties
| Compound Name | 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine |
| PubChem CID | 59131902 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine |
| SMILES | CNC(C)CC(OC)C(C)NC |
| InChI | InChI=1S/C9H22N2O/c1-7(10-3)6-9(12-5)8(2)11-4/h7-11H,6H2,1-5H3 |
| InChIKey | OAMPXUQJNYBICS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine?
The IUPAC name of 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine (CID 59131902) is 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine.
What is the SMILES notation for 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine?
The canonical SMILES for 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine is CNC(C)CC(OC)C(C)NC.
What is the InChIKey of 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine?
The InChIKey is OAMPXUQJNYBICS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-7(10-3)6-9(12-5)8(2)11-4/h7-11H,6H2,1-5H3.
What are the key properties of 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine?
3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine has a molecular weight of 174.29 g/mol, XLogP of 0.61, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-N,5-N-dimethylhexane-2,5-diamine is sourced from PubChem (CID 59131902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).