C24H32N2O4 — CID 59132187
(4R,5R,6R)-5-(2-methoxyethoxymethoxy)-4-[(4-methylphenyl)methyl]-6-(2-phenylethyl)-1,3-diazinan-2-one (PubChem CID 59132187) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is (4R,5R,6R)-5-(2-methoxyethoxymethoxy)-4-[(4-methylphenyl)methyl]-6-(2-phenylethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-5-(2-methoxyethoxymethoxy)-4-[(4-methylphenyl)methyl]-6-(2-phenylethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 59132187 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (4R,5R,6R)-5-(2-methoxyethoxymethoxy)-4-[(4-methylphenyl)methyl]-6-(2-phenylethyl)-1,3-diazinan-2-one |
| SMILES | COCCOCO[C@@H]1[C@@H](CCc2ccccc2)NC(=O)N[C@@H]1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C24H32N2O4/c1-18-8-10-20(11-9-18)16-22-23(30-17-29-15-14-28-2)21(25-24(27)26-22)13-12-19-6-4-3-5-7-19/h3-11,21-23H,12-17H2,1-2H3,(H2,25,26,27)/t21-,22-,23-/m1/s1 |
| InChIKey | NUZJTCGKHPPQJP-DNVJHFABSA-N |
| XLogP | 3.23 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|