About 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid
3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 59132613) has the molecular formula C26H20F3NO3S
and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid |
| PubChem CID | 59132613 |
| Molecular Formula | C26H20F3NO3S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CC(c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1)c1nccs1 |
| InChI | InChI=1S/C26H20F3NO3S/c27-26(28,29)21-8-4-18(5-9-21)20-3-1-2-17(14-20)16-33-22-10-6-19(7-11-22)23(15-24(31)32)25-30-12-13-34-25/h1-14,23H,15-16H2,(H,31,32) |
| InChIKey | QOFHEDPRZNXGRF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid?
The IUPAC name of 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid (CID 59132613) is 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid?
The canonical SMILES for 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid is O=C(O)CC(c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1)c1nccs1.
What is the InChIKey of 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid?
The InChIKey is QOFHEDPRZNXGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F3NO3S/c27-26(28,29)21-8-4-18(5-9-21)20-3-1-2-17(14-20)16-33-22-10-6-19(7-11-22)23(15-24(31)32)25-30-12-13-34-25/h1-14,23H,15-16H2,(H,31,32).
What are the key properties of 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid?
3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid has a molecular weight of 483.51 g/mol, XLogP of 7.01, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid is sourced from PubChem (CID 59132613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).