C25H32O8 — CID 59132614
5-[4,4-diethoxy-1-[4-(oxan-2-yloxy)phenyl]but-2-ynyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 59132614) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is 5-[4,4-diethoxy-1-[4-(oxan-2-yloxy)phenyl]but-2-ynyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[4,4-diethoxy-1-[4-(oxan-2-yloxy)phenyl]but-2-ynyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 59132614 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 5-[4,4-diethoxy-1-[4-(oxan-2-yloxy)phenyl]but-2-ynyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOC(C#CC(c1ccc(OC2CCCCO2)cc1)C1C(=O)OC(C)(C)OC1=O)OCC |
| InChI | InChI=1S/C25H32O8/c1-5-28-20(29-6-2)15-14-19(22-23(26)32-25(3,4)33-24(22)27)17-10-12-18(13-11-17)31-21-9-7-8-16-30-21/h10-13,19-22H,5-9,16H2,1-4H3 |
| InChIKey | RUQXMWVUPUGZMD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|