C28H28N6O4 — CID 59133254
ethyl 4-[[4-(3-methylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 59133254) has the molecular formula C28H28N6O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is ethyl 4-[[4-(3-methylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(3-methylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 59133254 |
| Molecular Formula | C28H28N6O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | ethyl 4-[[4-(3-methylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Nc3ccc(OC(=O)CC)cc3)nc(Nc3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C28H28N6O4/c1-4-24(35)38-23-15-13-21(14-16-23)30-27-32-26(29-20-11-9-19(10-12-20)25(36)37-5-2)33-28(34-27)31-22-8-6-7-18(3)17-22/h6-17H,4-5H2,1-3H3,(H3,29,30,31,32,33,34) |
| InChIKey | XGLQWVOKUWWYJR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|