About 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine
2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine (PubChem CID 59133463) has the molecular formula C56H36N10
and a molecular weight of 848.97 g/mol. Its IUPAC name is 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine.
Molecular Properties
| Compound Name | 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine |
| PubChem CID | 59133463 |
| Molecular Formula | C56H36N10 |
| Molecular Weight | 848.97 g/mol |
| Exact Mass | 848.31 |
| IUPAC Name | 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine |
| SMILES | c1cnc(-c2ccccc2-c2cc(-c3cnc(-c4cc(-c5ccccc5-c5ncccn5)cc(-c5ccccc5-c5ncccn5)c4)cn3)cc(-c3ccccc3-c3ncccn3)c2)nc1 |
| InChI | InChI=1S/C56H36N10/c1-5-17-47(53-57-21-9-22-58-53)43(13-1)37-29-38(44-14-2-6-18-48(44)54-59-23-10-24-60-54)32-41(31-37)51-35-66-52(36-65-51)42-33-39(45-15-3-7-19-49(45)55-61-25-11-26-62-55)30-40(34-42)46-16-4-8-20-50(46)56-63-27-12-28-64-56/h1-36H |
| InChIKey | PYWHBEDJHXOKAM-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 848.97 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine?
The IUPAC name of 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine (CID 59133463) is 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine.
What is the SMILES notation for 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine?
The canonical SMILES for 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine is c1cnc(-c2ccccc2-c2cc(-c3cnc(-c4cc(-c5ccccc5-c5ncccn5)cc(-c5ccccc5-c5ncccn5)c4)cn3)cc(-c3ccccc3-c3ncccn3)c2)nc1.
What is the InChIKey of 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine?
The InChIKey is PYWHBEDJHXOKAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H36N10/c1-5-17-47(53-57-21-9-22-58-53)43(13-1)37-29-38(44-14-2-6-18-48(44)54-59-23-10-24-60-54)32-41(31-37)51-35-66-52(36-65-51)42-33-39(45-15-3-7-19-49(45)55-61-25-11-26-62-55)30-40(34-42)46-16-4-8-20-50(46)56-63-27-12-28-64-56/h1-36H.
What are the key properties of 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine?
2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine has a molecular weight of 848.97 g/mol, XLogP of 12.31, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[3,5-bis(2-pyrimidin-2-ylphenyl)phenyl]pyrazine is sourced from PubChem (CID 59133463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).