C15H14F12O — CID 59133628
1,1,1,3,3,3-hexafluoro-2-[3-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol (PubChem CID 59133628) has the molecular formula C15H14F12O and a molecular weight of 438.25 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol |
|---|---|
| PubChem CID | 59133628 |
| Molecular Formula | C15H14F12O |
| Molecular Weight | 438.25 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol |
| SMILES | CC(CC1C2C=CC(C2)C1C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H14F12O/c1-10(12(16,17)18,13(19,20)21)5-8-6-2-3-7(4-6)9(8)11(28,14(22,23)24)15(25,26)27/h2-3,6-9,28H,4-5H2,1H3 |
| InChIKey | BKUHEXUORAQQOY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.25 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|