C25H29Cl2N5O6S — CID 59133976
1-(2,4-dichlorophenyl)sulfonyl-3-(dimethylamino)-6-[(4-nitrophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59133976) has the molecular formula C25H29Cl2N5O6S and a molecular weight of 598.51 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)sulfonyl-3-(dimethylamino)-6-[(4-nitrophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 1-(2,4-dichlorophenyl)sulfonyl-3-(dimethylamino)-6-[(4-nitrophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59133976 |
| Molecular Formula | C25H29Cl2N5O6S |
| Molecular Weight | 598.51 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)sulfonyl-3-(dimethylamino)-6-[(4-nitrophenyl)methyl]-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)C(N(C)C)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C25H29Cl2N5O6S/c1-15(2)29-14-23-30(39(37,38)22-10-7-17(26)12-19(22)27)13-21(28(3)4)25(34)31(23)20(24(29)33)11-16-5-8-18(9-6-16)32(35)36/h5-10,12,15,20-21,23H,11,13-14H2,1-4H3 |
| InChIKey | UDCVCQGBIOZIDQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 124.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|