C23H25Cl3N4O4S — CID 59134252
3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59134252) has the molecular formula C23H25Cl3N4O4S and a molecular weight of 559.90 g/mol. Its IUPAC name is 3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59134252 |
| Molecular Formula | C23H25Cl3N4O4S |
| Molecular Weight | 559.90 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | 3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)C(N)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H25Cl3N4O4S/c1-13(2)28-12-21-29(35(33,34)20-8-7-16(25)10-17(20)26)11-18(27)22(31)30(21)19(23(28)32)9-14-3-5-15(24)6-4-14/h3-8,10,13,18-19,21H,9,11-12,27H2,1-2H3 |
| InChIKey | ZUWQBEFIRKTVHB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |