C24H27FN2O3 — CID 59134311
(3R,4S)-4-[2-(4-fluorophenyl)ethylamino]-7-(hydroxymethyl)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 59134311) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is (3R,4S)-4-[2-(4-fluorophenyl)ethylamino]-7-(hydroxymethyl)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | (3R,4S)-4-[2-(4-fluorophenyl)ethylamino]-7-(hydroxymethyl)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 59134311 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (3R,4S)-4-[2-(4-fluorophenyl)ethylamino]-7-(hydroxymethyl)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(CO)nc2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN2O3/c1-14-10-17(13-28)27-20-11-19-21(12-18(14)20)30-24(2,3)23(29)22(19)26-9-8-15-4-6-16(25)7-5-15/h4-7,10-12,22-23,26,28-29H,8-9,13H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | WEPXBRHBWVVKAZ-XZOQPEGZSA-N |
| XLogP | 3.58 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |