C28H32ClFN2O4 — CID 59134348
tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-[2-(4-fluorophenyl)ethyl]carbamate (PubChem CID 59134348) has the molecular formula C28H32ClFN2O4 and a molecular weight of 515.03 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-[2-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-[2-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 59134348 |
| Molecular Formula | C28H32ClFN2O4 |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-[2-(4-fluorophenyl)ethyl]carbamate |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3N(CCc1ccc(F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H32ClFN2O4/c1-16-13-23(29)31-21-14-20-22(15-19(16)21)35-28(5,6)25(33)24(20)32(26(34)36-27(2,3)4)12-11-17-7-9-18(30)10-8-17/h7-10,13-15,24-25,33H,11-12H2,1-6H3/t24-,25+/m0/s1 |
| InChIKey | JIOZCPUEVIERGF-LOSJGSFVSA-N |
| XLogP | 6.39 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|