C16H18BrNO2 — CID 59134412
3-bromo-2,2,7,9-tetramethyl-3,4-dihydropyrano[2,3-g]quinolin-4-ol (PubChem CID 59134412) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 3-bromo-2,2,7,9-tetramethyl-3,4-dihydropyrano[2,3-g]quinolin-4-ol.
| Compound Name | 3-bromo-2,2,7,9-tetramethyl-3,4-dihydropyrano[2,3-g]quinolin-4-ol |
|---|---|
| PubChem CID | 59134412 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-bromo-2,2,7,9-tetramethyl-3,4-dihydropyrano[2,3-g]quinolin-4-ol |
| SMILES | Cc1cc(C)c2cc3c(cc2n1)C(O)C(Br)C(C)(C)O3 |
| InChI | InChI=1S/C16H18BrNO2/c1-8-5-9(2)18-12-6-11-13(7-10(8)12)20-16(3,4)15(17)14(11)19/h5-7,14-15,19H,1-4H3 |
| InChIKey | JWBJDRBMPWFJIT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|