About trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate
trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate (PubChem CID 59134782) has the molecular formula C20H18F2O2
and a molecular weight of 328.36 g/mol. Its IUPAC name is trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate |
| PubChem CID | 59134782 |
| Molecular Formula | C20H18F2O2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OCc2ccccc2)[C@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C20H18F2O2/c1-13-9-17(16-8-7-15(21)11-19(16)22)18(10-13)20(23)24-12-14-5-3-2-4-6-14/h2-8,11,17-18H,1,9-10,12H2/t17-,18+/m0/s1 |
| InChIKey | SIIJJSDFYZARES-ZWKOTPCHSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate?
The IUPAC name of trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate (CID 59134782) is trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate.
What is the SMILES notation for trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate?
The canonical SMILES for trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate is C=C1C[C@@H](C(=O)OCc2ccccc2)[C@H](c2ccc(F)cc2F)C1.
What is the InChIKey of trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate?
The InChIKey is SIIJJSDFYZARES-ZWKOTPCHSA-N. The full InChI is InChI=1S/C20H18F2O2/c1-13-9-17(16-8-7-15(21)11-19(16)22)18(10-13)20(23)24-12-14-5-3-2-4-6-14/h2-8,11,17-18H,1,9-10,12H2/t17-,18+/m0/s1.
What are the key properties of trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate?
trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate has a molecular weight of 328.36 g/mol, XLogP of 4.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-benzyl (1R,2R)-2-(2,4-difluorophenyl)-4-methylidenecyclopentane-1-carboxylate is sourced from PubChem (CID 59134782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).