C13H23NO2 — CID 59135095
3-tert-butyl-5-cyclohexyl-1,3-oxazolidin-2-one (PubChem CID 59135095) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-tert-butyl-5-cyclohexyl-1,3-oxazolidin-2-one.
| Compound Name | 3-tert-butyl-5-cyclohexyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59135095 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-tert-butyl-5-cyclohexyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)N1CC(C2CCCCC2)OC1=O |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)14-9-11(16-12(14)15)10-7-5-4-6-8-10/h10-11H,4-9H2,1-3H3 |
| InChIKey | LCTUUUUILGTVDI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |