About (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one
(4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one (PubChem CID 59135142) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 59135142 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@@H](C2CCCCC2)OC(=O)N1C(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-10-12(11-8-6-5-7-9-11)17-13(16)15(10)14(2,3)4/h10-12H,5-9H2,1-4H3/t10-,12-/m0/s1 |
| InChIKey | IUUWTWIRUGGHPF-JQWIXIFHSA-N |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one?
The IUPAC name of (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one (CID 59135142) is (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one is C[C@H]1[C@@H](C2CCCCC2)OC(=O)N1C(C)(C)C.
What is the InChIKey of (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one?
The InChIKey is IUUWTWIRUGGHPF-JQWIXIFHSA-N. The full InChI is InChI=1S/C14H25NO2/c1-10-12(11-8-6-5-7-9-11)17-13(16)15(10)14(2,3)4/h10-12H,5-9H2,1-4H3/t10-,12-/m0/s1.
What are the key properties of (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one?
(4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one has a molecular weight of 239.36 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-3-tert-butyl-5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 59135142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).