C15H10ClF3N4O — CID 59135403
4-[[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenol (PubChem CID 59135403) has the molecular formula C15H10ClF3N4O and a molecular weight of 354.72 g/mol. Its IUPAC name is 4-[[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenol.
| Compound Name | 4-[[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenol |
|---|---|
| PubChem CID | 59135403 |
| Molecular Formula | C15H10ClF3N4O |
| Molecular Weight | 354.72 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 4-[[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenol |
| SMILES | Oc1ccc(Nc2n[nH]c(-c3ccc(Cl)c(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C15H10ClF3N4O/c16-12-6-1-8(7-11(12)15(17,18)19)13-21-14(23-22-13)20-9-2-4-10(24)5-3-9/h1-7,24H,(H2,20,21,22,23) |
| InChIKey | ZAPRKPPDARXFIT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|