About 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine
5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 59135410) has the molecular formula C20H13F3N4O2
and a molecular weight of 398.34 g/mol. Its IUPAC name is 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine |
| PubChem CID | 59135410 |
| Molecular Formula | C20H13F3N4O2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | FC(F)(F)c1cccc(Nc2nnc(-c3ccc(Oc4cccnc4)cc3)o2)c1 |
| InChI | InChI=1S/C20H13F3N4O2/c21-20(22,23)14-3-1-4-15(11-14)25-19-27-26-18(29-19)13-6-8-16(9-7-13)28-17-5-2-10-24-12-17/h1-12H,(H,25,27) |
| InChIKey | KGCYIRBRVNASJU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine (CID 59135410) is 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine is FC(F)(F)c1cccc(Nc2nnc(-c3ccc(Oc4cccnc4)cc3)o2)c1.
What is the InChIKey of 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine?
The InChIKey is KGCYIRBRVNASJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N4O2/c21-20(22,23)14-3-1-4-15(11-14)25-19-27-26-18(29-19)13-6-8-16(9-7-13)28-17-5-2-10-24-12-17/h1-12H,(H,25,27).
What are the key properties of 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine?
5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine has a molecular weight of 398.34 g/mol, XLogP of 5.69, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-pyridin-3-yloxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 59135410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).