C27H27N5O4S3 — CID 59135981
N-(cyclopropylmethyl)-N-[2-[5-[(2-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide (PubChem CID 59135981) has the molecular formula C27H27N5O4S3 and a molecular weight of 581.75 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[2-[5-[(2-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide.
| Compound Name | N-(cyclopropylmethyl)-N-[2-[5-[(2-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59135981 |
| Molecular Formula | C27H27N5O4S3 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[2-[5-[(2-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide |
| SMILES | CN1C(=O)C2CN(Cc3cnc(-c4cc5cccc(N(CC6CC6)S(=O)(=O)c6cccs6)c5[nH]4)s3)CC2C1=O |
| InChI | InChI=1S/C27H27N5O4S3/c1-30-26(33)19-14-31(15-20(19)27(30)34)13-18-11-28-25(38-18)21-10-17-4-2-5-22(24(17)29-21)32(12-16-7-8-16)39(35,36)23-6-3-9-37-23/h2-6,9-11,16,19-20,29H,7-8,12-15H2,1H3 |
| InChIKey | DWGSFIGMASMNGS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|