About 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one
3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one (PubChem CID 59137742) has the molecular formula C20H18O2
and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one |
| PubChem CID | 59137742 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one |
| SMILES | C=Cc1ccc(C=C)c(C2C(=O)Oc3c(C)cc(C)cc32)c1 |
| InChI | InChI=1S/C20H18O2/c1-5-14-7-8-15(6-2)16(11-14)18-17-10-12(3)9-13(4)19(17)22-20(18)21/h5-11,18H,1-2H2,3-4H3 |
| InChIKey | DHETZTHUUIXCQP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one?
The IUPAC name of 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one (CID 59137742) is 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one.
What is the SMILES notation for 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one?
The canonical SMILES for 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one is C=Cc1ccc(C=C)c(C2C(=O)Oc3c(C)cc(C)cc32)c1.
What is the InChIKey of 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one?
The InChIKey is DHETZTHUUIXCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O2/c1-5-14-7-8-15(6-2)16(11-14)18-17-10-12(3)9-13(4)19(17)22-20(18)21/h5-11,18H,1-2H2,3-4H3.
What are the key properties of 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one?
3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one has a molecular weight of 290.36 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-bis(ethenyl)phenyl]-5,7-dimethyl-3H-1-benzofuran-2-one is sourced from PubChem (CID 59137742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).