C32H26O8 — CID 59137765
methyl 2-[[3-(2-methoxycarbonylprop-2-enyl)-2,6-dioxo-3,5-diphenylfuro[3,2-f][1]benzofuran-5-yl]methyl]prop-2-enoate (PubChem CID 59137765) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is methyl 2-[[3-(2-methoxycarbonylprop-2-enyl)-2,6-dioxo-3,5-diphenylfuro[3,2-f][1]benzofuran-5-yl]methyl]prop-2-enoate.
| Compound Name | methyl 2-[[3-(2-methoxycarbonylprop-2-enyl)-2,6-dioxo-3,5-diphenylfuro[3,2-f][1]benzofuran-5-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 59137765 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | methyl 2-[[3-(2-methoxycarbonylprop-2-enyl)-2,6-dioxo-3,5-diphenylfuro[3,2-f][1]benzofuran-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(CC1(c2ccccc2)C(=O)Oc2cc3c(cc21)C(CC(=C)C(=O)OC)(c1ccccc1)C(=O)O3)C(=O)OC |
| InChI | InChI=1S/C32H26O8/c1-19(27(33)37-3)17-31(21-11-7-5-8-12-21)23-15-24-26(16-25(23)39-29(31)35)40-30(36)32(24,18-20(2)28(34)38-4)22-13-9-6-10-14-22/h5-16H,1-2,17-18H2,3-4H3 |
| InChIKey | SKLRZOSTVJLFOQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|