C40H37N2O2+ — CID 59137802
4-[[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-1-yl]methyl]benzoic acid (PubChem CID 59137802) has the molecular formula C40H37N2O2+ and a molecular weight of 577.75 g/mol. Its IUPAC name is 4-[[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 59137802 |
| Molecular Formula | C40H37N2O2+ |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 4-[[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indol-1-yl]methyl]benzoic acid |
| SMILES | CN1/C(=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(Cc2ccc(C(=O)O)cc2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C40H36N2O2/c1-39(2)34(41(4)32-23-21-27-11-6-8-13-30(27)36(32)39)15-10-16-35-40(3,25-26-17-19-29(20-18-26)38(43)44)37-31-14-9-7-12-28(31)22-24-33(37)42(35)5/h6-24H,25H2,1-5H3/p+1 |
| InChIKey | KLDXEDPTJCSJPO-UHFFFAOYSA-O |
| XLogP | 8.79 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|