About CID 59138017
CID 59138017 (PubChem CID 59138017) has the molecular formula C7H13BO
and a molecular weight of 123.99 g/mol.
Molecular Properties
| Compound Name | CID 59138017 |
| PubChem CID | 59138017 |
| Molecular Formula | C7H13BO |
| Molecular Weight | 123.99 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | — |
| SMILES | [B]CC1CCC(C)(O)C1 |
| InChI | InChI=1S/C7H13BO/c1-7(9)3-2-6(4-7)5-8/h6,9H,2-5H2,1H3 |
| InChIKey | NJRJIOVNESBFEF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.99 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59138017 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59138017?
The IUPAC name of CID 59138017 (CID 59138017) is not available.
What is the SMILES notation for CID 59138017?
The canonical SMILES for CID 59138017 is [B]CC1CCC(C)(O)C1.
What is the InChIKey of CID 59138017?
The InChIKey is NJRJIOVNESBFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BO/c1-7(9)3-2-6(4-7)5-8/h6,9H,2-5H2,1H3.
What are the key properties of CID 59138017?
CID 59138017 has a molecular weight of 123.99 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59138017 is sourced from PubChem (CID 59138017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).