C10H18O3 — CID 59138394
1-[(2S,3S,4S)-5-hydroxy-3,4,6-trimethyloxan-2-yl]ethanone (PubChem CID 59138394) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-[(2S,3S,4S)-5-hydroxy-3,4,6-trimethyloxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4S)-5-hydroxy-3,4,6-trimethyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 59138394 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1-[(2S,3S,4S)-5-hydroxy-3,4,6-trimethyloxan-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1OC(C)C(O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H18O3/c1-5-6(2)10(7(3)11)13-8(4)9(5)12/h5-6,8-10,12H,1-4H3/t5-,6-,8?,9?,10-/m0/s1 |
| InChIKey | IVYUJSQRUYKAOK-RGYAZWNKSA-N |
| XLogP | 1.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |