About adamantane-2,6-diol
adamantane-2,6-diol (PubChem CID 591391) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is adamantane-2,6-diol.
Molecular Properties
| Compound Name | adamantane-2,6-diol |
| PubChem CID | 591391 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | adamantane-2,6-diol |
| SMILES | OC1C2CC3CC1CC(C2)C3O |
| InChI | InChI=1S/C10H16O2/c11-9-5-1-6-3-8(9)4-7(2-5)10(6)12/h5-12H,1-4H2 |
| InChIKey | MJHGVORZDBZFTH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantane-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-2,6-diol?
The IUPAC name of adamantane-2,6-diol (CID 591391) is adamantane-2,6-diol.
What is the SMILES notation for adamantane-2,6-diol?
The canonical SMILES for adamantane-2,6-diol is OC1C2CC3CC1CC(C2)C3O.
What is the InChIKey of adamantane-2,6-diol?
The InChIKey is MJHGVORZDBZFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c11-9-5-1-6-3-8(9)4-7(2-5)10(6)12/h5-12H,1-4H2.
What are the key properties of adamantane-2,6-diol?
adamantane-2,6-diol has a molecular weight of 168.24 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-2,6-diol is sourced from PubChem (CID 591391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).