About [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate
[3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 59139113) has the molecular formula C20H19ClN2O4
and a molecular weight of 386.84 g/mol. Its IUPAC name is [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| PubChem CID | 59139113 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1c(Cc2cccc(N)c2)c(=O)oc2cc(OC(=O)N(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C20H19ClN2O4/c1-11-14-9-16(21)18(27-20(25)23(2)3)10-17(14)26-19(24)15(11)8-12-5-4-6-13(22)7-12/h4-7,9-10H,8,22H2,1-3H3 |
| InChIKey | RSMXRBHNKITPCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate?
The IUPAC name of [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (CID 59139113) is [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate?
The canonical SMILES for [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate is Cc1c(Cc2cccc(N)c2)c(=O)oc2cc(OC(=O)N(C)C)c(Cl)cc12.
What is the InChIKey of [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate?
The InChIKey is RSMXRBHNKITPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O4/c1-11-14-9-16(21)18(27-20(25)23(2)3)10-17(14)26-19(24)15(11)8-12-5-4-6-13(22)7-12/h4-7,9-10H,8,22H2,1-3H3.
What are the key properties of [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate?
[3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate has a molecular weight of 386.84 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 59139113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).