About N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine
N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine (PubChem CID 59139248) has the molecular formula C25H29FN2OSi
and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine |
| PubChem CID | 59139248 |
| Molecular Formula | C25H29FN2OSi |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccnc(N=C(c2ccccc2)c2ccccc2)c1F |
| InChI | InChI=1S/C25H29FN2OSi/c1-25(2,3)30(4,5)29-18-21-16-17-27-24(22(21)26)28-23(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-17H,18H2,1-5H3 |
| InChIKey | OQESNPVFVCCGJW-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine?
The IUPAC name of N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine (CID 59139248) is N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine.
What is the SMILES notation for N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine?
The canonical SMILES for N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine is CC(C)(C)[Si](C)(C)OCc1ccnc(N=C(c2ccccc2)c2ccccc2)c1F.
What is the InChIKey of N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine?
The InChIKey is OQESNPVFVCCGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29FN2OSi/c1-25(2,3)30(4,5)29-18-21-16-17-27-24(22(21)26)28-23(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-17H,18H2,1-5H3.
What are the key properties of N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine?
N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine has a molecular weight of 420.60 g/mol, XLogP of 6.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-pyridinyl]-1,1-diphenylmethanimine is sourced from PubChem (CID 59139248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).