About 5-propan-2-yloxy-1,2,4-triazine
5-propan-2-yloxy-1,2,4-triazine (PubChem CID 59139279) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 5-propan-2-yloxy-1,2,4-triazine.
Molecular Properties
| Compound Name | 5-propan-2-yloxy-1,2,4-triazine |
| PubChem CID | 59139279 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 5-propan-2-yloxy-1,2,4-triazine |
| SMILES | CC(C)Oc1cnncn1 |
| InChI | InChI=1S/C6H9N3O/c1-5(2)10-6-3-8-9-4-7-6/h3-5H,1-2H3 |
| InChIKey | LVTWYTJJRAFNKP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-propan-2-yloxy-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yloxy-1,2,4-triazine?
The IUPAC name of 5-propan-2-yloxy-1,2,4-triazine (CID 59139279) is 5-propan-2-yloxy-1,2,4-triazine.
What is the SMILES notation for 5-propan-2-yloxy-1,2,4-triazine?
The canonical SMILES for 5-propan-2-yloxy-1,2,4-triazine is CC(C)Oc1cnncn1.
What is the InChIKey of 5-propan-2-yloxy-1,2,4-triazine?
The InChIKey is LVTWYTJJRAFNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-5(2)10-6-3-8-9-4-7-6/h3-5H,1-2H3.
What are the key properties of 5-propan-2-yloxy-1,2,4-triazine?
5-propan-2-yloxy-1,2,4-triazine has a molecular weight of 139.16 g/mol, XLogP of 0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yloxy-1,2,4-triazine is sourced from PubChem (CID 59139279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).