About 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene
2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene (PubChem CID 59140304) has the molecular formula C20H16O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene.
Molecular Properties
| Compound Name | 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene |
| PubChem CID | 59140304 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene |
| SMILES | C=C1CC(c2ccccc2)c2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C20H16O/c1-14-13-19(15-7-3-2-4-8-15)18-12-11-16-9-5-6-10-17(16)20(18)21-14/h2-12,19H,1,13H2 |
| InChIKey | GIJRPZRVGUTCOV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene?
The IUPAC name of 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene (CID 59140304) is 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene.
What is the SMILES notation for 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene?
The canonical SMILES for 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene is C=C1CC(c2ccccc2)c2ccc3ccccc3c2O1.
What is the InChIKey of 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene?
The InChIKey is GIJRPZRVGUTCOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O/c1-14-13-19(15-7-3-2-4-8-15)18-12-11-16-9-5-6-10-17(16)20(18)21-14/h2-12,19H,1,13H2.
What are the key properties of 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene?
2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene has a molecular weight of 272.35 g/mol, XLogP of 5.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4-phenyl-3,4-dihydrobenzo[h]chromene is sourced from PubChem (CID 59140304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).