C21H15N3O2 — CID 59140631
3-(1H-indol-3-yl)-14-oxa-5,6-diazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,9(16),10,12-pentaen-4-one (PubChem CID 59140631) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-14-oxa-5,6-diazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,9(16),10,12-pentaen-4-one.
| Compound Name | 3-(1H-indol-3-yl)-14-oxa-5,6-diazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,9(16),10,12-pentaen-4-one |
|---|---|
| PubChem CID | 59140631 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-(1H-indol-3-yl)-14-oxa-5,6-diazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,9(16),10,12-pentaen-4-one |
| SMILES | O=c1[nH]n2c(c1-c1c[nH]c3ccccc13)-c1coc3cccc(c13)CC2 |
| InChI | InChI=1S/C21H15N3O2/c25-21-19(14-10-22-16-6-2-1-5-13(14)16)20-15-11-26-17-7-3-4-12(18(15)17)8-9-24(20)23-21/h1-7,10-11,22H,8-9H2,(H,23,25) |
| InChIKey | FKDRLQFVKVYBCF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |