C49H45N2O8P — CID 59140808
4-[4-[[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline (PubChem CID 59140808) has the molecular formula C49H45N2O8P and a molecular weight of 820.88 g/mol. Its IUPAC name is 4-[4-[[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 4-[4-[[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 59140808 |
| Molecular Formula | C49H45N2O8P |
| Molecular Weight | 820.88 g/mol |
| Exact Mass | 820.29 |
| IUPAC Name | 4-[4-[[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline |
| SMILES | O=P1(C(c2ccc(Oc3ccc(N(CC4CO4)CC4CO4)cc3)cc2)c2ccc(Oc3ccc(N(CC4CO4)CC4CO4)cc3)cc2)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C49H45N2O8P/c52-60(48-8-4-2-6-46(48)45-5-1-3-7-47(45)59-60)49(33-9-17-37(18-10-33)57-39-21-13-35(14-22-39)50(25-41-29-53-41)26-42-30-54-42)34-11-19-38(20-12-34)58-40-23-15-36(16-24-40)51(27-43-31-55-43)28-44-32-56-44/h1-24,41-44,49H,25-32H2 |
| InChIKey | SPMORFLHAUNKRK-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.88 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|