About 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one
2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one (PubChem CID 59140862) has the molecular formula C20H11N3O4
and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one |
| PubChem CID | 59140862 |
| Molecular Formula | C20H11N3O4 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2ccc(-c3nc4ccccc4c(=O)o3)[nH]2)nc2ccccc12 |
| InChI | InChI=1S/C20H11N3O4/c24-19-11-5-1-3-7-13(11)22-17(26-19)15-9-10-16(21-15)18-23-14-8-4-2-6-12(14)20(25)27-18/h1-10,21H |
| InChIKey | IFARLYOOVGYCPS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one?
The IUPAC name of 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one (CID 59140862) is 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one?
The canonical SMILES for 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one is O=c1oc(-c2ccc(-c3nc4ccccc4c(=O)o3)[nH]2)nc2ccccc12.
What is the InChIKey of 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one?
The InChIKey is IFARLYOOVGYCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11N3O4/c24-19-11-5-1-3-7-13(11)22-17(26-19)15-9-10-16(21-15)18-23-14-8-4-2-6-12(14)20(25)27-18/h1-10,21H.
What are the key properties of 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one?
2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one has a molecular weight of 357.32 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-oxo-3,1-benzoxazin-2-yl)-1H-pyrrol-2-yl]-3,1-benzoxazin-4-one is sourced from PubChem (CID 59140862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).