About 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine
2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine (PubChem CID 59140883) has the molecular formula C20H14N2O2S
and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine |
| PubChem CID | 59140883 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine |
| SMILES | c1ccc2c(c1)COC(c1ccc(C3=Nc4ccccc4CO3)s1)=N2 |
| InChI | InChI=1S/C20H14N2O2S/c1-3-7-15-13(5-1)11-23-19(21-15)17-9-10-18(25-17)20-22-16-8-4-2-6-14(16)12-24-20/h1-10H,11-12H2 |
| InChIKey | BIWJRCIDTOGKJH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine?
The IUPAC name of 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine (CID 59140883) is 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine.
What is the SMILES notation for 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine?
The canonical SMILES for 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine is c1ccc2c(c1)COC(c1ccc(C3=Nc4ccccc4CO3)s1)=N2.
What is the InChIKey of 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine?
The InChIKey is BIWJRCIDTOGKJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O2S/c1-3-7-15-13(5-1)11-23-19(21-15)17-9-10-18(25-17)20-22-16-8-4-2-6-14(16)12-24-20/h1-10H,11-12H2.
What are the key properties of 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine?
2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine has a molecular weight of 346.41 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4H-3,1-benzoxazin-2-yl)thiophen-2-yl]-4H-3,1-benzoxazine is sourced from PubChem (CID 59140883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).