C16H25N5 — CID 59140959
5-isocyano-N,4-dimethyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine (PubChem CID 59140959) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is 5-isocyano-N,4-dimethyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine.
| Compound Name | 5-isocyano-N,4-dimethyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59140959 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 5-isocyano-N,4-dimethyl-N-[3-(1-methylpiperidin-4-yl)propyl]pyrimidin-2-amine |
| SMILES | [C-]#[N+]c1cnc(N(C)CCCC2CCN(C)CC2)nc1C |
| InChI | InChI=1S/C16H25N5/c1-13-15(17-2)12-18-16(19-13)21(4)9-5-6-14-7-10-20(3)11-8-14/h12,14H,5-11H2,1,3-4H3 |
| InChIKey | IEVWEUPWYVSLHN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|