C39H44O6S — CID 59141073
2-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]oxyoxane (PubChem CID 59141073) has the molecular formula C39H44O6S and a molecular weight of 640.84 g/mol. Its IUPAC name is 2-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]oxyoxane.
| Compound Name | 2-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]oxyoxane |
|---|---|
| PubChem CID | 59141073 |
| Molecular Formula | C39H44O6S |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 2-[(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]oxyoxane |
| SMILES | c1ccc(COC[C@H]2SC(OC3CCCCO3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H44O6S/c1-5-15-30(16-6-1)25-40-29-34-36(42-26-31-17-7-2-8-18-31)37(43-27-32-19-9-3-10-20-32)38(44-28-33-21-11-4-12-22-33)39(46-34)45-35-23-13-14-24-41-35/h1-12,15-22,34-39H,13-14,23-29H2/t34-,35?,36-,37+,38-,39?/m1/s1 |
| InChIKey | ZUINOYLWAULXBP-UBQULMPMSA-N |
| XLogP | 7.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |