About 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole
2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 59141277) has the molecular formula C26H20S4
and a molecular weight of 460.71 g/mol. Its IUPAC name is 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole.
Molecular Properties
| Compound Name | 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole |
| PubChem CID | 59141277 |
| Molecular Formula | C26H20S4 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | CCc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5ccc(CC)s5)cc4sc32)s1 |
| InChI | InChI=1S/C26H20S4/c1-3-17-7-11-21(27-17)15-5-9-19-23(13-15)29-26-20-10-6-16(14-24(20)30-25(19)26)22-12-8-18(4-2)28-22/h5-14H,3-4H2,1-2H3 |
| InChIKey | HRZSPYQMXCPFEW-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole?
The IUPAC name of 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole (CID 59141277) is 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole.
What is the SMILES notation for 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole?
The canonical SMILES for 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole is CCc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5ccc(CC)s5)cc4sc32)s1.
What is the InChIKey of 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole?
The InChIKey is HRZSPYQMXCPFEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20S4/c1-3-17-7-11-21(27-17)15-5-9-19-23(13-15)29-26-20-10-6-16(14-24(20)30-25(19)26)22-12-8-18(4-2)28-22/h5-14H,3-4H2,1-2H3.
What are the key properties of 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole?
2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole has a molecular weight of 460.71 g/mol, XLogP of 9.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis(5-ethylthiophen-2-yl)-[1]benzothiolo[3,2-b][1]benzothiole is sourced from PubChem (CID 59141277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).