C18H21N3O12 — CID 59141583
methyl 3-[[3,5-bis[(3-methoxycarbonyloxiran-2-yl)methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]oxirane-2-carboxylate (PubChem CID 59141583) has the molecular formula C18H21N3O12 and a molecular weight of 471.38 g/mol. Its IUPAC name is methyl 3-[[3,5-bis[(3-methoxycarbonyloxiran-2-yl)methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]oxirane-2-carboxylate.
| Compound Name | methyl 3-[[3,5-bis[(3-methoxycarbonyloxiran-2-yl)methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 59141583 |
| Molecular Formula | C18H21N3O12 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | methyl 3-[[3,5-bis[(3-methoxycarbonyloxiran-2-yl)methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]oxirane-2-carboxylate |
| SMILES | COC(=O)C1OC1Cn1c(=O)n(CC2OC2C(=O)OC)c(=O)n(CC2OC2C(=O)OC)c1=O |
| InChI | InChI=1S/C18H21N3O12/c1-28-13(22)10-7(31-10)4-19-16(25)20(5-8-11(32-8)14(23)29-2)18(27)21(17(19)26)6-9-12(33-9)15(24)30-3/h7-12H,4-6H2,1-3H3 |
| InChIKey | IJSBRQBGCKEOEQ-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 182.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|